* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7,8,9,10,11,12-HEXAHYDROCYCLOOCTA[5',6']PYRIDO[3',2':4,5]THIENO[3,2-D]PYRIMIDIN-4-AMINE |
English Synonyms: | 7,8,9,10,11,12-HEXAHYDROCYCLOOCTA[5',6']PYRIDO[3',2':4,5]THIENO[3,2-D]PYRIMIDIN-4-AMINE |
MDL Number.: | MFCD00712406 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c2c(nc3c1c4c(s3)c(ncn4)N)CCCCCC2 |
InChi: | InChI=1S/C15H16N4S/c16-14-13-12(17-8-18-14)10-7-9-5-3-1-2-4-6-11(9)19-15(10)20-13/h7-8H,1-6H2,(H2,16,17,18) |
InChiKey: | InChIKey=PWIDTOKXVLEAKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.