* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB016599 |
English Synonyms: | VITAS-BB TBB016599 |
MDL Number.: | MFCD00717927 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COC(=O)C1=CC=C(C=C1)C1C(C(=O)OCC2=CC=CC=C2)=C(C)NC2=C1C(=O)CC(C)(C)C2 |
InChi: | InChI=1S/C28H29NO5/c1-17-23(27(32)34-16-18-8-6-5-7-9-18)24(19-10-12-20(13-11-19)26(31)33-4)25-21(29-17)14-28(2,3)15-22(25)30/h5-13,24,29H,14-16H2,1-4H3 |
InChiKey: | InChIKey=SOFQBYPDYXQNJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.