* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035398 |
| English Synonyms: | VITAS-BB TBB035398 |
| MDL Number.: | MFCD00718149 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COC1=CC(=CC(Br)=C1O)C1NC(=O)N(C)C(C)=C1C(=O)OCCC1=CC=CC=C1 |
| InChi: | InChI=1S/C22H23BrN2O5/c1-13-18(21(27)30-10-9-14-7-5-4-6-8-14)19(24-22(28)25(13)2)15-11-16(23)20(26)17(12-15)29-3/h4-8,11-12,19,26H,9-10H2,1-3H3,(H,24,28) |
| InChiKey: | InChIKey=MQUWOZZPEKFACD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.