* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1317430 |
English Synonyms: | FCHGROUP FCH1317430 |
MDL Number.: | MFCD00725135 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCCS(=O)(=O)C1CS(=O)(=O)C=C1 |
InChi: | InChI=1S/C8H14O4S2/c1-2-3-5-14(11,12)8-4-6-13(9,10)7-8/h4,6,8H,2-3,5,7H2,1H3 |
InChiKey: | InChIKey=PERHLMBUXVYGHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.