* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(2,4-DINITROPHENOXY)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEXADECAFLUORONONANE |
English Synonyms: | 9-(2,4-DINITROPHENOXY)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEXADECAFLUORONONANE |
MDL Number.: | MFCD00729094 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1[N+](=O)[O-])[N+](=O)[O-])OCC(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
InChi: | InChI=1S/C15H6F16N2O5/c16-8(17)10(20,21)12(24,25)14(28,29)15(30,31)13(26,27)11(22,23)9(18,19)4-38-7-2-1-5(32(34)35)3-6(7)33(36)37/h1-3,8H,4H2 |
InChiKey: | InChIKey=NABWSENIPBYGOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.