* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB018882 |
| English Synonyms: | VITAS-BB TBB018882 |
| MDL Number.: | MFCD00729585 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC1=CC(=CC=C1)C(=O)NC1=C(C(N)=O)C2=C(CCCC2)S1 |
| InChi: | InChI=1S/C17H18N2O2S/c1-10-5-4-6-11(9-10)16(21)19-17-14(15(18)20)12-7-2-3-8-13(12)22-17/h4-6,9H,2-3,7-8H2,1H3,(H2,18,20)(H,19,21) |
| InChiKey: | InChIKey=LXLCGFMIVAOCIO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.