* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 1-(4-AMINO-1,2,5-OXADIAZOL-3-YL)-5-PHENYL-1H-1,2,3-TRIAZOLE-4-CARBOXYLATE |
| English Synonyms: | ETHYL 1-(4-AMINO-1,2,5-OXADIAZOL-3-YL)-5-PHENYL-1H-1,2,3-TRIAZOLE-4-CARBOXYLATE |
| MDL Number.: | MFCD00747978 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)c1c(n(nn1)c2c(non2)N)c3ccccc3 |
| InChi: | InChI=1S/C13H12N6O3/c1-2-21-13(20)9-10(8-6-4-3-5-7-8)19(18-15-9)12-11(14)16-22-17-12/h3-7H,2H2,1H3,(H2,14,16) |
| InChiKey: | InChIKey=XZSMHRAGXUUTQP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.