* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1358349 |
| English Synonyms: | VITAS-BB TBB016964 ; OTAVA-BB 1358349 |
| MDL Number.: | MFCD00762381 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COC(=O)C1=C(NC(=O)C2C3CC(C=C3)C2C(O)=O)C=CC=C1 |
| InChi: | InChI=1S/C17H17NO5/c1-23-17(22)11-4-2-3-5-12(11)18-15(19)13-9-6-7-10(8-9)14(13)16(20)21/h2-7,9-10,13-14H,8H2,1H3,(H,18,19)(H,20,21) |
| InChiKey: | InChIKey=CLFOLRNDKGIRRK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.