Molecular Structure:
CCD No.:CCD00160306
OTAVA-BB 1358100
Formula:C16 H17 N O4
MolWeight:287.313
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1358100 |
| English Synonyms： | OTAVA-BB 1358100 |
| MDL Number.： | MFCD00762385 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | COc1cccc(c1)NC(=O)C2C3CC(C2C(=O)O)C=C3 |
| InChi： | InChI=1S/C16H17NO4/c1-21-12-4-2-3-11(8-12)17-15(18)13-9-5-6-10(7-9)14(13)16(19)20/h2-6,8-10,13-14H,7H2,1H3,(H,17,18)(H,19,20) |
| InChiKey： | InChIKey=BIZXJOLLOODDNH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
