* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FCHGROUP FCH829491 |
English Synonyms: | FCHGROUP FCH829491 |
MDL Number.: | MFCD00775258 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1P(=O)(CS1)O |
InChi: | InChI=1S/C2H5O2PS/c3-5(4)1-6-2-5/h1-2H2,(H,3,4) |
InChiKey: | InChIKey=DZNCHORQQWFQFG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.