* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-PHENYL-3,4,5,6,7,9-HEXAHYDRO-1H-XANTHENE-1,8(2H)-DIONE |
English Synonyms: | 9-PHENYL-3,4,5,6,7,9-HEXAHYDRO-1H-XANTHENE-1,8(2H)-DIONE |
MDL Number.: | MFCD00775535 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C2C3=C(CCCC3=O)OC4=C2C(=O)CCC4 |
InChi: | InChI=1S/C19H18O3/c20-13-8-4-10-15-18(13)17(12-6-2-1-3-7-12)19-14(21)9-5-11-16(19)22-15/h1-3,6-7,17H,4-5,8-11H2 |
InChiKey: | InChIKey=GRNGVFFDAIAPRQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.