* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 26250664 |
| English Synonyms: | EMOLECULES 26250664 |
| MDL Number.: | MFCD00778535 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)/C(=C\1/CC(N(CC1C)C)C)/C#N |
| InChi: | InChI=1S/C13H20N2O2/c1-5-17-13(16)12(7-14)11-6-10(3)15(4)8-9(11)2/h9-10H,5-6,8H2,1-4H3/b12-11- |
| InChiKey: | InChIKey=BDKQNXZHEKKITA-QXMHVHEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.