* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 1262600 |
| English Synonyms: | EMOLECULES 1262600 |
| MDL Number.: | MFCD00778602 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCCCCCC(=O)C1CCOC(C1)(C)C |
| InChi: | InChI=1S/C14H26O2/c1-4-5-6-7-8-13(15)12-9-10-16-14(2,3)11-12/h12H,4-11H2,1-3H3 |
| InChiKey: | InChIKey=BGBCRXDWXMMWFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.