* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024398 |
| English Synonyms: | VITAS-BB TBB024398 |
| MDL Number.: | MFCD00779724 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | FC1=CC=C(\C=N\NC(=O)C2=CC=C(C=C2)C(=O)N\N=C\C2=CC=C(F)C=C2)C=C1 |
| InChi: | InChI=1S/C22H16F2N4O2/c23-19-9-1-15(2-10-19)13-25-27-21(29)17-5-7-18(8-6-17)22(30)28-26-14-16-3-11-20(24)12-4-16/h1-14H,(H,27,29)(H,28,30)/b25-13+,26-14+ |
| InChiKey: | InChIKey=XCXHHNFNTODHKR-BKHCZYBLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.