* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 1231783 |
| English Synonyms: | EMOLECULES 1231783 |
| MDL Number.: | MFCD00783351 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)c1c2c(sc1NC(=O)CNC(C)c3ccccc3)CCCC2 |
| InChi: | InChI=1S/C21H26N2O3S/c1-3-26-21(25)19-16-11-7-8-12-17(16)27-20(19)23-18(24)13-22-14(2)15-9-5-4-6-10-15/h4-6,9-10,14,22H,3,7-8,11-13H2,1-2H3,(H,23,24) |
| InChiKey: | InChIKey=VENTXROOLBSRPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.