* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ELLANOVALABS 38-0072 |
| English Synonyms: | ELLANOVALABS 38-0072 |
| MDL Number.: | MFCD00790241 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C[C]1[CH][CH][CH][CH][C]1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChi: | InChI=1S/C8H10.3CO.Cr/c1-7-5-3-4-6-8(7)2;3*1-2;/h3-6H,1-2H3;;;; |
| InChiKey: | InChIKey=NOHKERUDDYWNCW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.