* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FERRIC OXALATE |
English Synonyms: | FERRIC OXALATE |
MDL Number.: | MFCD00792262 |
H bond acceptor: | 12 |
H bond donor: | 0 |
Smile: | C1(=O)C(=O)O[Fe]2OC(=O)C(=O)O[Fe](O1)OC(=O)C(=O)O2 |
InChi: | InChI=1S/3C2H2O4.2Fe/c3*3-1(4)2(5)6;;/h3*(H,3,4)(H,5,6);;/q;;;2*+3/p-6 |
InChiKey: | InChIKey=VEPSWGHMGZQCIN-UHFFFAOYSA-H |
* If the product has intellectual property rights, a license granted is must or contact us.