* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BENZYL-3-THIA-7-AZABICYCLO(3.3.1)NONAN-9-ONE |
| CAS: | 89398-04-9 |
| English Synonyms: | (1R,5S)-7-BENZYL-3-THIA-7-AZABICYCLO[3.3.1]NONAN-9-ONE ; 7-BENZYL-3-THIA-7-AZABICYCLO(3.3.1)NONAN-9-ONE |
| MDL Number.: | MFCD00795098 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)CN2C[C@@H]3CSC[C@H](C2)C3=O |
| InChi: | InChI=1S/C14H17NOS/c16-14-12-7-15(8-13(14)10-17-9-12)6-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13+ |
| InChiKey: | InChIKey=ONSHXQWGCKFQFZ-BETUJISGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.