* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC FERULATE |
| English Synonyms: | ZINC FERULATE |
| MDL Number.: | MFCD00797394 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | COc1cc(ccc1O)/C=C/C(=O)O[Zn]OC(=O)/C=C/c2ccc(c(c2)OC)O |
| InChi: | InChI=1S/2C10H10O4.Zn/c2*1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;/h2*2-6,11H,1H3,(H,12,13);/q;;+2/p-2/b2*5-3+; |
| InChiKey: | InChIKey=IKIYTNWLWLUVAL-MSEGBBJSSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.