* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC GLUTAMATE |
| CAS: | 14269-55-7 |
| English Synonyms: | ZINC GLUTAMATE |
| MDL Number.: | MFCD00797395 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C1CC(=O)O[Zn]OC(=O)[C@H]1N |
| InChi: | InChI=1S/C5H9NO4.Zn/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+2/p-2/t3-;/m0./s1 |
| InChiKey: | InChIKey=GAMIYQSIKAOVTG-DFWYDOINSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.