* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL (2E)-NON-2-ENOATE |
English Synonyms: | ETHYL-2-NONENOATE ; ETHYL (2E)-NON-2-ENOATE |
MDL Number.: | MFCD00798030 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCCCC/C=C/C(=O)OCC |
InChi: | InChI=1S/C11H20O2/c1-3-5-6-7-8-9-10-11(12)13-4-2/h9-10H,3-8H2,1-2H3/b10-9+ |
InChiKey: | InChIKey=ZCSDUGXKKBIICL-MDZDMXLPSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.