Molecular Structure:
CCD No.:CCD00165463
ESTAZOLAM-D5
CAS No.:
170082-16-3
Formula:C16 H6 Cl D5 N4
MolWeight:299.774
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | ESTAZOLAM-D5 |
| CAS： | 170082-16-3 |
| English Synonyms： | ESTAZOLAM-D5 |
| MDL Number.： | MFCD00798476 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | [2H]c1c(c(c(c(c1[2H])[2H])C2=NCc3nncn3-c4c2cc(cc4)Cl)[2H])[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
