* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | J ACID IMIDE |
| English Synonyms: | J ACID IMIDE |
| MDL Number.: | MFCD00798500 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | c1cc2c(cc1N)cc(cc2O)S(=O)(=O)NS(=O)(=O)c3cc4cc(ccc4c(c3)O)N |
| InChi: | InChI=1S/C20H17N3O6S2/c21-13-1-3-17-11(5-13)7-15(9-19(17)24)30(26,27)23-31(28,29)16-8-12-6-14(22)2-4-18(12)20(25)10-16/h1-10,23-25H,21-22H2 |
| InChiKey: | InChIKey=QLMXMSCORMDKHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.