* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | O(4)-ETHYLTHYMIDINE |
| CAS: | 59495-22-6 |
| English Synonyms: | O(4)-ETHYLTHYMIDINE |
| MDL Number.: | MFCD00800200 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCOc1c(cn(c(=O)n1)[C@H]2C[C@@H]([C@H](O2)CO)O)C |
| InChi: | InChI=1S/C12H18N2O5/c1-3-18-11-7(2)5-14(12(17)13-11)10-4-8(16)9(6-15)19-10/h5,8-10,15-16H,3-4,6H2,1-2H3/t8-,9+,10+/m0/s1 |
| InChiKey: | InChIKey=QZVVYDMWOGPALV-IVZWLZJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.