* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VAT BLUE 14 |
| CAS: | 1324-27-2 |
| English Synonyms: | CI VAR BLUE 14 ; VAT BLUE 14 |
| MDL Number.: | MFCD00800442 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)C(=O)C3=C(C2=O)C=c4c(cc5=CC6=C(Cc5n4)C(=O)c7cccc(c7C6=O)Cl)C3 |
| InChi: | InChI=1S/C29H14ClNO4/c30-22-7-3-6-17-25(22)29(35)19-10-14-8-13-9-18-20(11-23(13)31-24(14)12-21(19)28(17)34)27(33)16-5-2-1-4-15(16)26(18)32/h1-8,10-11H,9,12H2 |
| InChiKey: | InChIKey=NHAKKGRAHSSERD-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.