* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VAT BLACK 25 |
| CAS: | 4395-53-3 |
| English Synonyms: | VAT BLACK 25 ; CI VAT BLACK 25 |
| MDL Number.: | MFCD00800443 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)C(=O)c3cccc(c3C2=O)Nc4ccc5c(c4)c(=O)c6ccc7c8ccc9c(c8[nH]c1c7c6c5C(=O)C1)C(=O)c1ccccc1C9=O |
| InChi: | InChI=1S/C45H22N2O6/c48-34-19-33-35-21(23-15-17-30-39(40(23)47-33)45(53)27-9-4-2-7-25(27)42(30)50)14-16-29-38(35)37(34)22-13-12-20(18-31(22)43(29)51)46-32-11-5-10-28-36(32)44(52)26-8-3-1-6-24(26)41(28)49/h1-18,46-47H,19H2 |
| InChiKey: | InChIKey=NZPZPCFEKAOOPB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.