* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VAT YELLOW 33 |
| CAS: | 12227-50-8 |
| English Synonyms: | CI VAT YELLOW 33 ; VAT YELLOW 33 |
| MDL Number.: | MFCD00800446 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)C(=O)c3cccc(c3C2=O)NC(=O)c4ccc(cc4)c5ccc(cc5)/N=N/c6ccc(cc6)c7ccc(cc7)C(=O)Nc8cccc9c8C(=O)c1ccccc1C9=O |
| InChi: | InChI=1S/C54H32N4O6/c59-49-39-7-1-3-9-41(39)51(61)47-43(49)11-5-13-45(47)55-53(63)35-19-15-31(16-20-35)33-23-27-37(28-24-33)57-58-38-29-25-34(26-30-38)32-17-21-36(22-18-32)54(64)56-46-14-6-12-44-48(46)52(62)42-10-4-2-8-40(42)50(44)60/h1-30H,(H,55,63)(H,56,64)/b58-57+ |
| InChiKey: | InChIKey=AJDUTMFFZHIJEM-UPRQXYPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.