* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JAPONILURE |
| CAS: | 64726-91-6 |
| English Synonyms: | JAPONLURE ; JAPONILURE |
| MDL Number.: | MFCD00801078 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCCCCCCC/C=C\[C@H]1CCC(=O)O1 |
| InChi: | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-13-11-12-14(15)16-13/h9-10,13H,2-8,11-12H2,1H3/b10-9-/t13-/m0/s1 |
| InChiKey: | InChIKey=QTGIYXFCSKXKMO-XPSMFNQNSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.