* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JAPONILURE |
CAS: | 64726-91-6 |
English Synonyms: | JAPONILURE ; JAPONLURE |
MDL Number.: | MFCD00801078 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCCCCCC/C=C\[C@H]1CCC(=O)O1 |
InChi: | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-13-11-12-14(15)16-13/h9-10,13H,2-8,11-12H2,1H3/b10-9-/t13-/m0/s1 |
InChiKey: | InChIKey=QTGIYXFCSKXKMO-XPSMFNQNSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.