* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-HYDROXY-3-PHENYL-5H-[1,3]THIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| English Synonyms: | 7-HYDROXY-3-PHENYL-5H-[1,3]THIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| MDL Number.: | MFCD00807910 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2csc3n2c(=O)cc(n3)O |
| InChi: | InChI=1S/C12H8N2O2S/c15-10-6-11(16)14-9(7-17-12(14)13-10)8-4-2-1-3-5-8/h1-7,15H |
| InChiKey: | InChIKey=VGSYONPCMZLPBZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.