* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INULICIN |
| CAS: | 33627-41-7 |
| English Synonyms: | INULICIN |
| MDL Number.: | MFCD00808445 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1C(C2C(CC(=C1CCCOC(=O)C)C)OC(=O)C2=C)O |
| InChi: | InChI=1S/C17H24O5/c1-9-8-14-15(11(3)17(20)22-14)16(19)10(2)13(9)6-5-7-21-12(4)18/h10,14-16,19H,3,5-8H2,1-2,4H3 |
| InChiKey: | InChIKey=QKVABRCMWRXFAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.