* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DINAPHTHO[1,2-B:1',2'-D]FURAN |
CAS: | 207-93-2 |
English Synonyms: | DINAPHTHO[1,2-B:1',2'-D]FURAN ; DINAPHTHO[2,1-B:1',2'-D]FURAN |
MDL Number.: | MFCD00828266 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)ccc3c2c4ccc5ccccc5c4o3 |
InChi: | InChI=1S/C20H12O/c1-3-7-15-13(5-1)10-12-18-19(15)17-11-9-14-6-2-4-8-16(14)20(17)21-18/h1-12H |
InChiKey: | InChIKey=MNXYJVWXMUBENA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.