* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(2-BROMOETHYL)-1,3-DIMETHYL-1,2,3,4,6,7,8,9-OCTAHYDROPYRIMIDO[2,1-F]PURINE-2,4-DIONE |
English Synonyms: | 9-(2-BROMOETHYL)-1,3-DIMETHYL-1,2,3,4,6,7,8,9-OCTAHYDROPYRIMIDO[2,1-F]PURINE-2,4-DIONE |
MDL Number.: | MFCD00829267 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | Cn1c2c(c(=O)n(c1=O)C)n3c(n2)N(CCC3)CCBr |
InChi: | InChI=1S/C12H16BrN5O2/c1-15-9-8(10(19)16(2)12(15)20)18-6-3-5-17(7-4-13)11(18)14-9/h3-7H2,1-2H3 |
InChiKey: | InChIKey=QESMZTQFUCEHFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.