* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,4-DITHIASPIRO[4.5]DECAN-6-ONE |
CAS: | 27694-08-2 |
English Synonyms: | 1,4-DITHIASPIRO[4.5]DECAN-6-ONE |
MDL Number.: | MFCD00830407 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1CCC2(C(=O)C1)SCCS2 |
InChi: | InChI=1S/C8H12OS2/c9-7-3-1-2-4-8(7)10-5-6-11-8/h1-6H2 |
InChiKey: | InChIKey=FKUJTNZQICPTED-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.