* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 9856229 |
| English Synonyms: | EMOLECULES 9856229 |
| MDL Number.: | MFCD00841097 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)C(=O)Nc2c(c3c(s2)CCCC3)C#N)O |
| InChi: | InChI=1S/C16H14N2O2S/c17-9-12-10-5-2-4-8-14(10)21-16(12)18-15(20)11-6-1-3-7-13(11)19/h1,3,6-7,19H,2,4-5,8H2,(H,18,20) |
| InChiKey: | InChIKey=NWUYLJCKNAEWIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.