* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURETHIDINE |
CAS: | 2385-81-1 |
English Synonyms: | FURETHIDINE |
MDL Number.: | MFCD00864219 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOC(=O)C1(CCN(CC1)CCOCC2CCCO2)c3ccccc3 |
InChi: | InChI=1S/C21H31NO4/c1-2-25-20(23)21(18-7-4-3-5-8-18)10-12-22(13-11-21)14-16-24-17-19-9-6-15-26-19/h3-5,7-8,19H,2,6,9-17H2,1H3 |
InChiKey: | InChIKey=NNCOZXNZFLUYGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.