* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TILIDINE |
CAS: | 20380-58-9 |
English Synonyms: | TILIDINE |
MDL Number.: | MFCD00864248 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCOC(=O)[C@@]1(CCC=C[C@H]1N(C)C)c2ccccc2 |
InChi: | InChI=1S/C17H23NO2/c1-4-20-16(19)17(14-10-6-5-7-11-14)13-9-8-12-15(17)18(2)3/h5-8,10-12,15H,4,9,13H2,1-3H3/t15-,17+/m1/s1 |
InChiKey: | InChIKey=WDEFBBTXULIOBB-WBVHZDCISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.