* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DOXPICOMINE |
| CAS: | 62904-71-6 |
| English Synonyms: | DOXPICOMINE |
| MDL Number.: | MFCD00864254 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CN(C)C(c1cccnc1)C2COCOC2 |
| InChi: | InChI=1S/C12H18N2O2/c1-14(2)12(10-4-3-5-13-6-10)11-7-15-9-16-8-11/h3-6,11-12H,7-9H2,1-2H3 |
| InChiKey: | InChIKey=SMZVRZPJXBGNFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.