* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DUOMETACIN |
| CAS: | 25771-23-7 |
| English Synonyms: | DUOMETACIN |
| MDL Number.: | MFCD00864258 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1c(c2ccc(cc2n1CC(=O)O)OC)C(=O)c3ccc(cc3)OC |
| InChi: | InChI=1S/C20H19NO5/c1-12-19(20(24)13-4-6-14(25-2)7-5-13)16-9-8-15(26-3)10-17(16)21(12)11-18(22)23/h4-10H,11H2,1-3H3,(H,22,23) |
| InChiKey: | InChIKey=NWNBRKHCXIQLDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.