* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIFENAMIZOLE |
| CAS: | 20170-20-1 |
| English Synonyms: | DIFENAMIZOLE |
| MDL Number.: | MFCD00864379 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C(=O)Nc1cc(nn1c2ccccc2)c3ccccc3)N(C)C |
| InChi: | InChI=1S/C20H22N4O/c1-15(23(2)3)20(25)21-19-14-18(16-10-6-4-7-11-16)22-24(19)17-12-8-5-9-13-17/h4-15H,1-3H3,(H,21,25) |
| InChiKey: | InChIKey=PCXMKBOWWVXEDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.