* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GUAFECAINOL |
CAS: | 36199-78-7 |
English Synonyms: | GUAFECAINOL |
MDL Number.: | MFCD00864420 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCN(CC)CCOCC(COc1ccccc1OC)O |
InChi: | InChI=1S/C16H27NO4/c1-4-17(5-2)10-11-20-12-14(18)13-21-16-9-7-6-8-15(16)19-3/h6-9,14,18H,4-5,10-13H2,1-3H3 |
InChiKey: | InChIKey=DHCZIHSQOICDAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.