* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RODOCAINE |
CAS: | 38821-80-6 |
English Synonyms: | RODOCAINE |
MDL Number.: | MFCD00864430 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1NC(=O)CCN2CCC[C@@H]3[C@@H]2CCC3)Cl |
InChi: | InChI=1S/C18H25ClN2O/c1-13-5-2-8-15(19)18(13)20-17(22)10-12-21-11-4-7-14-6-3-9-16(14)21/h2,5,8,14,16H,3-4,6-7,9-12H2,1H3,(H,20,22)/t14-,16+/m1/s1 |
InChiKey: | InChIKey=ICLIXBRUSBYXEV-ZBFHGGJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.