* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | NAEPAINE |
| CAS: | 2188-67-2 |
| English Synonyms: | NAEPAINE |
| MDL Number.: | MFCD00864431 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCCCNCCOC(=O)c1ccc(cc1)N |
| InChi: | InChI=1S/C14H22N2O2/c1-2-3-4-9-16-10-11-18-14(17)12-5-7-13(15)8-6-12/h5-8,16H,2-4,9-11,15H2,1H3 |
| InChiKey: | InChIKey=UYXHCVFXDBNRQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.