* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KETOCAINE |
| CAS: | 1092-46-2 |
| English Synonyms: | KETOCAINE |
| MDL Number.: | MFCD00864462 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCCC(=O)c1ccccc1OCCN(C(C)C)C(C)C |
| InChi: | InChI=1S/C18H29NO2/c1-6-9-17(20)16-10-7-8-11-18(16)21-13-12-19(14(2)3)15(4)5/h7-8,10-11,14-15H,6,9,12-13H2,1-5H3 |
| InChiKey: | InChIKey=UXAWFWFJXIANHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.