* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENBUTRAZATE |
CAS: | 4378-36-3 |
English Synonyms: | FENBUTRAZATE |
MDL Number.: | MFCD00864478 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCC(c1ccccc1)C(=O)OCCN2CCOC(C2C)c3ccccc3 |
InChi: | InChI=1S/C23H29NO3/c1-3-21(19-10-6-4-7-11-19)23(25)27-17-15-24-14-16-26-22(18(24)2)20-12-8-5-9-13-20/h4-13,18,21-22H,3,14-17H2,1-2H3 |
InChiKey: | InChIKey=BAQKJENAVQLANS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.