* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BROMOXANIDE |
| CAS: | 41113-86-4 |
| English Synonyms: | BROMOXANIDE |
| MDL Number.: | MFCD00864520 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cc1c(cc(c(c1C(=O)Nc2ccc(cc2C(F)(F)F)Br)O)C(C)(C)C)[N+](=O)[O-] |
| InChi: | InChI=1S/C19H18BrF3N2O4/c1-9-14(25(28)29)8-12(18(2,3)4)16(26)15(9)17(27)24-13-6-5-10(20)7-11(13)19(21,22)23/h5-8,26H,1-4H3,(H,24,27) |
| InChiKey: | InChIKey=WRPRKPMHLLGGIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.