* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | STILBAZIUM IODIDE |
| CAS: | 3784-99-4 |
| English Synonyms: | STILBAZIUM IODIDE |
| MDL Number.: | MFCD00864523 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC[n+]1c(cccc1/C=C/c2ccc(cc2)N3CCCC3)/C=C/c4ccc(cc4)N5CCCC5.[I-] |
| InChi: | InChI=1S/C31H36N3.HI/c1-2-34-30(20-14-26-10-16-28(17-11-26)32-22-3-4-23-32)8-7-9-31(34)21-15-27-12-18-29(19-13-27)33-24-5-6-25-33;/h7-21H,2-6,22-25H2,1H3;1H/q+1;/p-1 |
| InChiKey: | InChIKey=BYIRBDUHSVOFLU-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.