* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DESASPIDIN |
| CAS: | 114-43-2 |
| English Synonyms: | DESASPIDIN |
| MDL Number.: | MFCD00864530 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CCCC(=O)c1c(cc(c(c1O)CC2=C(C(C(=C(C2=O)C(=O)CCC)O)(C)C)O)OC)O |
| InChi: | InChI=1S/C24H30O8/c1-6-8-14(25)18-16(27)11-17(32-5)12(20(18)28)10-13-21(29)19(15(26)9-7-2)23(31)24(3,4)22(13)30/h11,27-28,30-31H,6-10H2,1-5H3 |
| InChiKey: | InChIKey=GAHOBHHMYUYJDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.