* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BROTIANIDE |
| CAS: | 23233-88-7 |
| English Synonyms: | BROTIANIDE |
| MDL Number.: | MFCD00864542 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(=O)Oc1c(cc(cc1Br)Cl)C(=S)Nc2ccc(cc2)Br |
| InChi: | InChI=1S/C15H10Br2ClNO2S/c1-8(20)21-14-12(6-10(18)7-13(14)17)15(22)19-11-4-2-9(16)3-5-11/h2-7H,1H3,(H,19,22) |
| InChiKey: | InChIKey=NRFGEDASJHBPPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.