* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLUSOXOLOL |
CAS: | 84057-96-5 |
English Synonyms: | FLUSOXOLOL |
MDL Number.: | MFCD00864558 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C)NC[C@H](COc1ccc(cc1)OCCOCCc2ccc(cc2)F)O |
InChi: | InChI=1S/C22H30FNO4/c1-17(2)24-15-20(25)16-28-22-9-7-21(8-10-22)27-14-13-26-12-11-18-3-5-19(23)6-4-18/h3-10,17,20,24-25H,11-16H2,1-2H3/t20-/m1/s1 |
InChiKey: | InChIKey=CYCXZGUVPDRYLG-HXUWFJFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.