* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FALINTOLOL |
| CAS: | 88134-91-2 |
| English Synonyms: | FALINTOLOL |
| MDL Number.: | MFCD00864559 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C/C(=N\OCC(CNC(C)(C)C)O)/C1CC1 |
| InChi: | InChI=1S/C12H24N2O2/c1-9(10-5-6-10)14-16-8-11(15)7-13-12(2,3)4/h10-11,13,15H,5-8H2,1-4H3/b14-9+ |
| InChiKey: | InChIKey=IYQDIWRBEQWANY-NTEUORMPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.